| Name | Benzoyl Acetic Acid |
| Synonyms | PHENYLIUM(R) Benzoyl Acetic Acid PHENOXYETHANOIC ACID PHENYLOXYL ACETIC ACID β-Oxobenzenepropanoic acid PHENYL ETHER GLYCOLIC ACID 3-Phenyl-3-oxopropionic acid 3-oxo-3-phenylpropanoic acid 3-Keto-3-phenylpropionic acid |
| CAS | 614-20-0 |
| EINECS | 204-556-7 |
| InChI | InChI=1/C9H8O3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12) |
| Molecular Formula | C9H8O3 |
| Molar Mass | 164.16 |
| Density | 1.242±0.06 g/cm3(Predicted) |
| Melting Point | 98-100°C(lit.) |
| Boling Point | 349.1±25.0 °C(Predicted) |
| Flash Point | 179.1°C |
| Vapor Presure | 1.81E-05mmHg at 25°C |
| pKa | 2.76±0.32(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.556 |
| Physical and Chemical Properties | Melting point 103-104 ℃ (decomposition), slightly soluble in water. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | AJ2230000 |